CAS 191611-20-8 appears in our catalog under these names: (S)–2–Amino–2–cyclohexylacetic acid hydrochloride, H-Chg-oh HCl, H-Chg-oh hcl, 97%, 97%, (S)-2-Amino-2-cyclohexylacetic acid hydrochloride, 97%, H-Chg-OH·HCl, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 10g, 25g.
(2S)-2-amino-2-cyclohexylacetic acid;hydrochloride (CAS 191611-20-8) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: (2S)-2-amino-2-cyclohexylacetic acid;hydrochloride. InChIKey: QMUIOFNZAZPFFT-FJXQXJEOSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | (2S)-2-amino-2-cyclohexylacetic acid;hydrochloride |
| InChIKey | QMUIOFNZAZPFFT-FJXQXJEOSA-N |
| SMILES | C1CCC(CC1)[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)