Products 1916479-73-6
CAS 1916479-73-6 is the registry number for tert-butyl (2S,4R)-4-fluoropyrrolidine-2-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (2S,4R)-4-fluoropyrrolidine-2-carboxylate (CAS 1916479-73-6) is a chemical compound with the molecular formula C9H16FNO2 and a molecular weight of 189.23 g/mol. IUPAC name: tert-butyl (2S,4R)-4-fluoropyrrolidine-2-carboxylate. InChIKey: JMORIDAQGDQESW-RQJHMYQMSA-N.
| Molecular formula | C9H16FNO2 |
|---|---|
| Molecular weight | 189.23 g/mol |
| IUPAC name | tert-butyl (2S,4R)-4-fluoropyrrolidine-2-carboxylate |
| InChIKey | JMORIDAQGDQESW-RQJHMYQMSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@H](CN1)F |
Computed by PubChem (NCBI)