CAS 1916512-40-7 is the registry number for N,N'-(2,5-Dimethyl-1,4-phenylene)diisonicotinamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2,5-dimethyl-4-(pyridine-4-carbonylamino)phenyl]pyridine-4-carboxamide (CAS 1916512-40-7) is a chemical compound with the molecular formula C20H18N4O2 and a molecular weight of 346.4 g/mol. IUPAC name: N-[2,5-dimethyl-4-(pyridine-4-carbonylamino)phenyl]pyridine-4-carboxamide. InChIKey: DRJUZBOVBDMERL-UHFFFAOYSA-N.
| Molecular formula | C20H18N4O2 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | N-[2,5-dimethyl-4-(pyridine-4-carbonylamino)phenyl]pyridine-4-carboxamide |
| InChIKey | DRJUZBOVBDMERL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1NC(=O)C2=CC=NC=C2)C)NC(=O)C3=CC=NC=C3 |
Computed by PubChem (NCBI)