CAS 321531-61-7 is the registry number for N1,N3-Bis(pyridin-2-ylmethyl)isophthalamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-N,3-N-bis(pyridin-2-ylmethyl)benzene-1,3-dicarboxamide (CAS 321531-61-7) is a chemical compound with the molecular formula C20H18N4O2 and a molecular weight of 346.4 g/mol. IUPAC name: 1-N,3-N-bis(pyridin-2-ylmethyl)benzene-1,3-dicarboxamide. InChIKey: BCSQPSJHVFGECU-UHFFFAOYSA-N.
| Molecular formula | C20H18N4O2 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 1-N,3-N-bis(pyridin-2-ylmethyl)benzene-1,3-dicarboxamide |
| InChIKey | BCSQPSJHVFGECU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNC(=O)C2=CC(=CC=C2)C(=O)NCC3=CC=CC=N3 |
Computed by PubChem (NCBI)