CAS 2362-26-7 is the registry number for N,N'-(1,4-Phenylene)bis(4-aminobenzamide), 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-amino-N-[4-[(4-aminobenzoyl)amino]phenyl]benzamide (CAS 2362-26-7) is a chemical compound with the molecular formula C20H18N4O2 and a molecular weight of 346.4 g/mol. IUPAC name: 4-amino-N-[4-[(4-aminobenzoyl)amino]phenyl]benzamide. InChIKey: LGTGOCSQAOUUFP-UHFFFAOYSA-N.
| Molecular formula | C20H18N4O2 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 4-amino-N-[4-[(4-aminobenzoyl)amino]phenyl]benzamide |
| InChIKey | LGTGOCSQAOUUFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC=C(C=C2)NC(=O)C3=CC=C(C=C3)N)N |
Computed by PubChem (NCBI)