Products 191674-95-0
CAS 191674-95-0 is the registry number for 2-(7-Ethyl-1H-indol-3-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(7-ethyl-1H-indol-3-yl)acetic acid (CAS 191674-95-0) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 2-(7-ethyl-1H-indol-3-yl)acetic acid. InChIKey: KVQHDBXIAODINU-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 2-(7-ethyl-1H-indol-3-yl)acetic acid |
| InChIKey | KVQHDBXIAODINU-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C(=CN2)CC(=O)O |
Computed by PubChem (NCBI)