Products 1919035-44-1

CAS 1919035-44-1 is the registry number for Ethyl 5-hydroxy-2-methyl-2H-1,2,3-triazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2-methyl-5-oxo-1H-triazole-4-carboxylate (CAS 1919035-44-1) is a chemical compound with the molecular formula C6H9N3O3 and a molecular weight of 171.15 g/mol. IUPAC name: ethyl 2-methyl-5-oxo-1H-triazole-4-carboxylate. InChIKey: ORDBMPZDWFKQIE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9N3O3
Molecular weight171.15 g/mol
IUPAC nameethyl 2-methyl-5-oxo-1H-triazole-4-carboxylate
InChIKeyORDBMPZDWFKQIE-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NN(NC1=O)C

Computed by PubChem (NCBI)