Products 192069-24-2
CAS 192069-24-2 is the registry number for N-((1R,2R)-2-Hydroxy-1-methyl-2-phenylethyl)-N-methylformamide. Offered by: TRC. Available pack sizes: 100mg.
N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylformamide (CAS 192069-24-2) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylformamide. InChIKey: RPFBXDFMFZGQFB-KOLCDFICSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylformamide |
| InChIKey | RPFBXDFMFZGQFB-KOLCDFICSA-N |
| SMILES | C[C@H]([C@@H](C1=CC=CC=C1)O)N(C)C=O |
Computed by PubChem (NCBI)