CAS 1923052-20-3 appears in our catalog under these names: 7-Fluoro-2,2-dimethyl-3,4-dihydro-2h-benzo[b][1,4]oxazine-6-carbonitrile, 95%, 7–Fluoro–2,2–dimethyl–3,4–dihydro–2H–benzo(b)(1,4)oxazine–6–carbonitrile. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
7-fluoro-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine-6-carbonitrile (CAS 1923052-20-3) is a chemical compound with the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. IUPAC name: 7-fluoro-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine-6-carbonitrile. InChIKey: RQYFBEBUJLTEOX-UHFFFAOYSA-N.
| Molecular formula | C11H11FN2O |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 7-fluoro-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine-6-carbonitrile |
| InChIKey | RQYFBEBUJLTEOX-UHFFFAOYSA-N |
| SMILES | CC1(CNC2=C(O1)C=C(C(=C2)C#N)F)C |
Computed by PubChem (NCBI)