CAS 899926-79-5 is the registry number for 5-(4-Fluorophenyl)-2,2-dimethyl-2,3-dihydro-4h-imidazol-4-one, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(4-fluorophenyl)-2,2-dimethyl-1H-imidazol-5-one (CAS 899926-79-5) is a chemical compound with the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. IUPAC name: 4-(4-fluorophenyl)-2,2-dimethyl-1H-imidazol-5-one. InChIKey: IFGLOEBULPVPCR-UHFFFAOYSA-N.
| Molecular formula | C11H11FN2O |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-2,2-dimethyl-1H-imidazol-5-one |
| InChIKey | IFGLOEBULPVPCR-UHFFFAOYSA-N |
| SMILES | CC1(NC(=O)C(=N1)C2=CC=C(C=C2)F)C |
Computed by PubChem (NCBI)