Products 2270908-45-5
CAS 2270908-45-5 is the registry number for 4-(3-Fluorobenzyl)-5-methyl-1,2-dihydro-3h-pyrazol-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[(3-fluorophenyl)methyl]-5-methyl-1,2-dihydropyrazol-3-one (CAS 2270908-45-5) is a chemical compound with the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. IUPAC name: 4-[(3-fluorophenyl)methyl]-5-methyl-1,2-dihydropyrazol-3-one. InChIKey: BPYPTLPQNDMFIU-UHFFFAOYSA-N.
| Molecular formula | C11H11FN2O |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 4-[(3-fluorophenyl)methyl]-5-methyl-1,2-dihydropyrazol-3-one |
| InChIKey | BPYPTLPQNDMFIU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NN1)CC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)