CAS 1923069-32-2 is the registry number for (R)-Methyl 2-(trifluoromethyl)pyrrolidine-2-carboxylate hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg.
Methyl (2R)-2-(trifluoromethyl)pyrrolidine-2-carboxylate;hydrochloride (CAS 1923069-32-2) is a chemical compound with the molecular formula C7H11ClF3NO2 and a molecular weight of 233.61 g/mol. IUPAC name: methyl (2R)-2-(trifluoromethyl)pyrrolidine-2-carboxylate;hydrochloride. InChIKey: RYMXOTPXTKYOLW-FYZOBXCZSA-N.
| Molecular formula | C7H11ClF3NO2 |
|---|---|
| Molecular weight | 233.61 g/mol |
| IUPAC name | methyl (2R)-2-(trifluoromethyl)pyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | RYMXOTPXTKYOLW-FYZOBXCZSA-N |
| SMILES | COC(=O)[C@]1(CCCN1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)