CAS 2140264-93-1 appears in our catalog under these names: Methyl (3r,4r)-4-(trifluoromethyl)pyrrolidine-3-carboxylate hydrochloride, 95%, Methyl (3R,4R)-4-(trifluoromethyl)pyrrolidine-3-carboxylate hydrochloride, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 100mg, 10g, 5g, 1g, 250mg, 500mg.
Methyl (3R,4R)-4-(trifluoromethyl)pyrrolidine-3-carboxylate;hydrochloride (CAS 2140264-93-1) is a chemical compound with the molecular formula C7H11ClF3NO2 and a molecular weight of 233.61 g/mol. IUPAC name: methyl (3R,4R)-4-(trifluoromethyl)pyrrolidine-3-carboxylate;hydrochloride. InChIKey: RQQYZTONTAQRGS-FHAQVOQBSA-N.
| Molecular formula | C7H11ClF3NO2 |
|---|---|
| Molecular weight | 233.61 g/mol |
| IUPAC name | methyl (3R,4R)-4-(trifluoromethyl)pyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | RQQYZTONTAQRGS-FHAQVOQBSA-N |
| SMILES | COC(=O)[C@H]1CNC[C@@H]1C(F)(F)F.Cl |
Computed by PubChem (NCBI)