CAS 1955493-11-4 appears in our catalog under these names: 4-(Trifluoromethyl)piperidine-2-carboxylic acid hydrochloride, 4-(trifluoromethyl)piperidine-2-carboxylic acid hydrochloride, 95%, 4-(Trifluoromethyl)piperidine-2-carboxylic acid hydrochloride, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 50mg, 250mg, 1g.
4-(trifluoromethyl)piperidine-2-carboxylic acid;hydrochloride (CAS 1955493-11-4) is a chemical compound with the molecular formula C7H11ClF3NO2 and a molecular weight of 233.61 g/mol. IUPAC name: 4-(trifluoromethyl)piperidine-2-carboxylic acid;hydrochloride. InChIKey: AUVSQLGRTJCCRX-UHFFFAOYSA-N.
| Molecular formula | C7H11ClF3NO2 |
|---|---|
| Molecular weight | 233.61 g/mol |
| IUPAC name | 4-(trifluoromethyl)piperidine-2-carboxylic acid;hydrochloride |
| InChIKey | AUVSQLGRTJCCRX-UHFFFAOYSA-N |
| SMILES | C1CNC(CC1C(F)(F)F)C(=O)O.Cl |
Computed by PubChem (NCBI)