Products 1923088-42-9

CAS 1923088-42-9 is the registry number for 2-methyl-2-(pyrrolidin-1-yl)propan-1-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.

Structural formula: {0} (CAS {1})

2-methyl-2-pyrrolidin-1-ylpropan-1-amine;dihydrochloride (CAS 1923088-42-9) is a chemical compound with the molecular formula C8H20Cl2N2 and a molecular weight of 215.16 g/mol. IUPAC name: 2-methyl-2-pyrrolidin-1-ylpropan-1-amine;dihydrochloride. InChIKey: HURMHLCIFQNIPK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H20Cl2N2
Molecular weight215.16 g/mol
IUPAC name2-methyl-2-pyrrolidin-1-ylpropan-1-amine;dihydrochloride
InChIKeyHURMHLCIFQNIPK-UHFFFAOYSA-N
SMILESCC(C)(CN)N1CCCC1.Cl.Cl

Computed by PubChem (NCBI)