CAS 1965314-72-0 appears in our catalog under these names: (S)-1-Isopropyl-3-methylpiperazine dihydrochloride, 95%, (S)–1–Isopropyl–3–methyl–piperazine dihydrochloride, (S)-1-Isopropyl-3-methyl-piperazine dihydrochloride, 95%, 95%, (S)-1-Isopropyl-3-methyl-piperazine dihydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 50mg, 500mg.
(3S)-3-methyl-1-propan-2-ylpiperazine;dihydrochloride (CAS 1965314-72-0) is a chemical compound with the molecular formula C8H20Cl2N2 and a molecular weight of 215.16 g/mol. IUPAC name: (3S)-3-methyl-1-propan-2-ylpiperazine;dihydrochloride. InChIKey: IJQBDFLIEYUUSD-JZGIKJSDSA-N.
| Molecular formula | C8H20Cl2N2 |
|---|---|
| Molecular weight | 215.16 g/mol |
| IUPAC name | (3S)-3-methyl-1-propan-2-ylpiperazine;dihydrochloride |
| InChIKey | IJQBDFLIEYUUSD-JZGIKJSDSA-N |
| SMILES | C[C@H]1CN(CCN1)C(C)C.Cl.Cl |
Computed by PubChem (NCBI)