CAS 2239348-70-8 is the registry number for (1R,2R)-N1,N1-Dimethylcyclohexane-1,2-diamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Trans-(1R,2R)-2-N,2-N-dimethylcyclohexane-1,2-diamine;dihydrochloride (CAS 2239348-70-8) is a chemical compound with the molecular formula C8H20Cl2N2 and a molecular weight of 215.16 g/mol. IUPAC name: trans-(1R,2R)-2-N,2-N-dimethylcyclohexane-1,2-diamine;dihydrochloride. InChIKey: BZJVMZDYSWJIIG-RHJRFJOKSA-N.
| Molecular formula | C8H20Cl2N2 |
|---|---|
| Molecular weight | 215.16 g/mol |
| IUPAC name | trans-(1R,2R)-2-N,2-N-dimethylcyclohexane-1,2-diamine;dihydrochloride |
| InChIKey | BZJVMZDYSWJIIG-RHJRFJOKSA-N |
| SMILES | CN(C)[C@@H]1CCCC[C@H]1N.Cl.Cl |
Computed by PubChem (NCBI)