CAS 192374-15-5 appears in our catalog under these names: (R,R)-Hydroxy Bupropion, Bupropion Impurity 13, (R,R)-Hydroxy Bupropion, >95% (HPLC), Bupropion impurity 16. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
(2R,3R)-2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol (CAS 192374-15-5) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: (2R,3R)-2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol. InChIKey: RCOBKSKAZMVBHT-RNCFNFMXSA-N.
| Molecular formula | C13H18ClNO2 |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | (2R,3R)-2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol |
| InChIKey | RCOBKSKAZMVBHT-RNCFNFMXSA-N |
| SMILES | C[C@@H]1[C@](OCC(N1)(C)C)(C2=CC(=CC=C2)Cl)O |
Computed by PubChem (NCBI)