Products 357399-43-0
CAS 357399-43-0 appears in our catalog under these names: Bupropion Morpholinol (Hydroxy Bupropion), Hydroxy Bupropion, >95% (HPLC), Hydroxy Bupropion, (±)-Hydroxybupropion, 2-Hydroxy-2-(3-chlorophenyl)-3,5,5-trimethylmorpholine, 98%, 98%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 2mg, 50mg, 1mg.
2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol (CAS 357399-43-0) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: 2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol. InChIKey: RCOBKSKAZMVBHT-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO2 |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol |
| InChIKey | RCOBKSKAZMVBHT-UHFFFAOYSA-N |
| SMILES | CC1C(OCC(N1)(C)C)(C2=CC(=CC=C2)Cl)O |
Computed by PubChem (NCBI)