Products 24008-82-0
CAS 24008-82-0 appears in our catalog under these names: H–Ser–Tyr–βNA, H-Ser-Tyr-betaNA, Ser-Tyr β-naphthylamide. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 250mg, 2000mg, 1000mg, 5000mg, 25 mg, 100 mg, 50 mg.
(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)-N-naphthalen-2-ylpropanamide (CAS 24008-82-0) is a chemical compound with the molecular formula C22H23N3O4 and a molecular weight of 393.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)-N-naphthalen-2-ylpropanamide. InChIKey: MAQKGNBGUVFWNR-PMACEKPBSA-N.
| Molecular formula | C22H23N3O4 |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)-N-naphthalen-2-ylpropanamide |
| InChIKey | MAQKGNBGUVFWNR-PMACEKPBSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)NC(=O)[C@H](CC3=CC=C(C=C3)O)NC(=O)[C@H](CO)N |
Computed by PubChem (NCBI)