CAS 19263-36-6 appears in our catalog under these names: 2,6-Di-tert-butyl-4-vinylphenol, 95%, 2,6–Di–tert–butyl–4–vinylphenol, 2,6-Di-tert-butyl-4-vinylphenol 95%, 2,6-Bis(1,1-dimethylethyl)-4-ethenylphenol, 95%, 95%, 2,6-Di-tert-butyl-4-vinylphenol. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, HPC Standards. Available pack sizes: 100mg, 5g, 1g, 250mg, 1x10mg, 10g.
2,6-ditert-butyl-4-ethenylphenol (CAS 19263-36-6) is a chemical compound with the molecular formula C16H24O and a molecular weight of 232.36 g/mol. IUPAC name: 2,6-ditert-butyl-4-ethenylphenol. InChIKey: ZMRCFZFFKWFWSK-UHFFFAOYSA-N.
| Molecular formula | C16H24O |
|---|---|
| Molecular weight | 232.36 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-ethenylphenol |
| InChIKey | ZMRCFZFFKWFWSK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)C=C |
Computed by PubChem (NCBI)