CAS 24249-82-9 is the registry number for 2,4,6-Triisopropylbenzaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6-tri(propan-2-yl)benzaldehyde (CAS 24249-82-9) is a chemical compound with the molecular formula C16H24O and a molecular weight of 232.36 g/mol. IUPAC name: 2,4,6-tri(propan-2-yl)benzaldehyde. InChIKey: XAAXOSJFQFKYIM-UHFFFAOYSA-N.
| Molecular formula | C16H24O |
|---|---|
| Molecular weight | 232.36 g/mol |
| IUPAC name | 2,4,6-tri(propan-2-yl)benzaldehyde |
| InChIKey | XAAXOSJFQFKYIM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)C=O)C(C)C |
Computed by PubChem (NCBI)