CAS 65253-04-5 appears in our catalog under these names: (-)-8-Phenylmenthol, >95% (HPLC), (–)–8–Phenylmenthol, (-)-8-Phenylmenthol, 97%, (1R,2S,5R)-5-Methyl-2-(2-phenylpropan-2-yl)cyclohexanol, ≥98%, ≥98%. Offered by: TRC, GLPBio, Thermo Scientific (Acros), Chemat. Available pack sizes: 1g, 250mg, 500mg, 100mg.
(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol (CAS 65253-04-5) is a chemical compound with the molecular formula C16H24O and a molecular weight of 232.36 g/mol. IUPAC name: (1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol. InChIKey: WTQIZFCJMGWUGZ-BPLDGKMQSA-N.
| Molecular formula | C16H24O |
|---|---|
| Molecular weight | 232.36 g/mol |
| IUPAC name | (1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol |
| InChIKey | WTQIZFCJMGWUGZ-BPLDGKMQSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)O)C(C)(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)