CAS 367272-51-3 appears in our catalog under these names: Ac-dl-phe(3-cn)-oh, 95%, Ac-DL-Phe(3-CN)-OH, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-acetamido-3-(3-cyanophenyl)propanoic acid (CAS 367272-51-3) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 232.23 g/mol. IUPAC name: 2-acetamido-3-(3-cyanophenyl)propanoic acid. InChIKey: ODSLGEVQHKOHHK-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 2-acetamido-3-(3-cyanophenyl)propanoic acid |
| InChIKey | ODSLGEVQHKOHHK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC1=CC(=CC=C1)C#N)C(=O)O |
Computed by PubChem (NCBI)