Products 1930-54-7

CAS 1930-54-7 is the registry number for 4-Bromo-9-methoxy-7H-furo(3,2-g)chromen-7-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

4-bromo-9-methoxyfuro[3,2-g]chromen-7-one (CAS 1930-54-7) is a chemical compound with the molecular formula C12H7BrO4 and a molecular weight of 295.08 g/mol. IUPAC name: 4-bromo-9-methoxyfuro[3,2-g]chromen-7-one. InChIKey: LQDFTMLCQBZFKE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7BrO4
Molecular weight295.08 g/mol
IUPAC name4-bromo-9-methoxyfuro[3,2-g]chromen-7-one
InChIKeyLQDFTMLCQBZFKE-UHFFFAOYSA-N
SMILESCOC1=C2C(=C(C3=C1OC(=O)C=C3)Br)C=CO2

Computed by PubChem (NCBI)