CAS 1930-54-7 is the registry number for 4-Bromo-9-methoxy-7H-furo(3,2-g)chromen-7-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
4-bromo-9-methoxyfuro[3,2-g]chromen-7-one (CAS 1930-54-7) is a chemical compound with the molecular formula C12H7BrO4 and a molecular weight of 295.08 g/mol. IUPAC name: 4-bromo-9-methoxyfuro[3,2-g]chromen-7-one. InChIKey: LQDFTMLCQBZFKE-UHFFFAOYSA-N.
| Molecular formula | C12H7BrO4 |
|---|---|
| Molecular weight | 295.08 g/mol |
| IUPAC name | 4-bromo-9-methoxyfuro[3,2-g]chromen-7-one |
| InChIKey | LQDFTMLCQBZFKE-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C3=C1OC(=O)C=C3)Br)C=CO2 |
Computed by PubChem (NCBI)