Products 860650-57-3

CAS 860650-57-3 is the registry number for 1-Bromonaphthalene-2,6-dicarboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-bromonaphthalene-2,6-dicarboxylic acid (CAS 860650-57-3) is a chemical compound with the molecular formula C12H7BrO4 and a molecular weight of 295.08 g/mol. IUPAC name: 1-bromonaphthalene-2,6-dicarboxylic acid. InChIKey: FMOUJOOWTROKLA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7BrO4
Molecular weight295.08 g/mol
IUPAC name1-bromonaphthalene-2,6-dicarboxylic acid
InChIKeyFMOUJOOWTROKLA-UHFFFAOYSA-N
SMILESC1=CC2=C(C=CC(=C2Br)C(=O)O)C=C1C(=O)O

Computed by PubChem (NCBI)