CAS 77189-69-6 appears in our catalog under these names: 6–Bromo–5,8–dioxo–5,8–dihydronaphthalen–1–yl acetate, 6-Bromo-5,8-dioxo-5,8-dihydronaphthalen-1-yl acetate, 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
(6-bromo-5,8-dioxonaphthalen-1-yl) acetate (CAS 77189-69-6) is a chemical compound with the molecular formula C12H7BrO4 and a molecular weight of 295.08 g/mol. IUPAC name: (6-bromo-5,8-dioxonaphthalen-1-yl) acetate. InChIKey: KRQAKZDHQJXULZ-UHFFFAOYSA-N.
| Molecular formula | C12H7BrO4 |
|---|---|
| Molecular weight | 295.08 g/mol |
| IUPAC name | (6-bromo-5,8-dioxonaphthalen-1-yl) acetate |
| InChIKey | KRQAKZDHQJXULZ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC2=C1C(=O)C=C(C2=O)Br |
Computed by PubChem (NCBI)