CAS 193022-04-7 appears in our catalog under these names: Cts-1027, 95%, CTS-1027, CTS–1027, CTS-1027 99%, CTS-1027, 99%, 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 10mg, 50mg, 5mg, 25mg, 2mg, 10mM (in 1ml dmso), 100mg, 250mg.
4-[[4-(4-chlorophenoxy)phenyl]sulfonylmethyl]-N-hydroxyoxane-4-carboxamide (CAS 193022-04-7) is a chemical compound with the molecular formula C19H20ClNO6S and a molecular weight of 425.9 g/mol. IUPAC name: 4-[[4-(4-chlorophenoxy)phenyl]sulfonylmethyl]-N-hydroxyoxane-4-carboxamide. InChIKey: ROSNVSQTEGHUKU-UHFFFAOYSA-N.
| Molecular formula | C19H20ClNO6S |
|---|---|
| Molecular weight | 425.9 g/mol |
| IUPAC name | 4-[[4-(4-chlorophenoxy)phenyl]sulfonylmethyl]-N-hydroxyoxane-4-carboxamide |
| InChIKey | ROSNVSQTEGHUKU-UHFFFAOYSA-N |
| SMILES | C1COCCC1(CS(=O)(=O)C2=CC=C(C=C2)OC3=CC=C(C=C3)Cl)C(=O)NO |
Computed by PubChem (NCBI)