CAS 380427-16-7 appears in our catalog under these names: 2-Chloro-5-diethylsulfamoyl-benzoic acid 4-formyl-2-methoxy-phenyl ester, 95%, 4-Formyl-2-methoxyphenyl 2-chloro-5-(diethylsulfamoyl)benzoate, 95%, 4-Formyl-2-methoxyphenyl 2-chloro-5-(diethylsulfamoyl)benzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
(4-formyl-2-methoxyphenyl) 2-chloro-5-(diethylsulfamoyl)benzoate (CAS 380427-16-7) is a chemical compound with the molecular formula C19H20ClNO6S and a molecular weight of 425.9 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) 2-chloro-5-(diethylsulfamoyl)benzoate. InChIKey: MIJKECXILATYTR-UHFFFAOYSA-N.
| Molecular formula | C19H20ClNO6S |
|---|---|
| Molecular weight | 425.9 g/mol |
| IUPAC name | (4-formyl-2-methoxyphenyl) 2-chloro-5-(diethylsulfamoyl)benzoate |
| InChIKey | MIJKECXILATYTR-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=C(C=C1)Cl)C(=O)OC2=C(C=C(C=C2)C=O)OC |
Computed by PubChem (NCBI)