Products 72678-30-9
CAS 72678-30-9 is the registry number for LS2265. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, Get quote.
2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethanesulfonic acid (CAS 72678-30-9) is a chemical compound with the molecular formula C19H20ClNO6S and a molecular weight of 425.9 g/mol. IUPAC name: 2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethanesulfonic acid. InChIKey: IYNIXDBLAVOMAW-UHFFFAOYSA-N.
| Molecular formula | C19H20ClNO6S |
|---|---|
| Molecular weight | 425.9 g/mol |
| IUPAC name | 2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethanesulfonic acid |
| InChIKey | IYNIXDBLAVOMAW-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NCCS(=O)(=O)O)OC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)