CAS 193086-27-0 is the registry number for N-Fmoc-N-methyl-3-(1-naphthyl)-D-alanine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-naphthalen-1-ylpropanoic acid (CAS 193086-27-0) is a chemical compound with the molecular formula C29H25NO4 and a molecular weight of 451.5 g/mol. IUPAC name: (2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-naphthalen-1-ylpropanoic acid. InChIKey: MHVRUCBIMARVSP-HHHXNRCGSA-N.
| Molecular formula | C29H25NO4 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | (2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-naphthalen-1-ylpropanoic acid |
| InChIKey | MHVRUCBIMARVSP-HHHXNRCGSA-N |
| SMILES | CN([C@H](CC1=CC=CC2=CC=CC=C21)C(=O)O)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)