Products 2044520-06-9
CAS 2044520-06-9 appears in our catalog under these names: VK–2019, VK-2019, 99.97%, VK-2019, 98%, 2-(1H-Indol-6-yl)-3-((4-(((tetrahydro-2H-pyran-4-yl)oxy)methyl)phenyl)ethynyl)benzoic acid, 98%. Offered by: GLPBio, MedChemExpress, Ambeed, BLDpharm. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 5 mg, 25 mg, 10mM/1mL, 100mg.
2-(1H-indol-6-yl)-3-[2-[4-(oxan-4-yloxymethyl)phenyl]ethynyl]benzoic acid (CAS 2044520-06-9) is a chemical compound with the molecular formula C29H25NO4 and a molecular weight of 451.5 g/mol. IUPAC name: 2-(1H-indol-6-yl)-3-[2-[4-(oxan-4-yloxymethyl)phenyl]ethynyl]benzoic acid. InChIKey: VUJZFNSWCNSGDV-UHFFFAOYSA-N.
| Molecular formula | C29H25NO4 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | 2-(1H-indol-6-yl)-3-[2-[4-(oxan-4-yloxymethyl)phenyl]ethynyl]benzoic acid |
| InChIKey | VUJZFNSWCNSGDV-UHFFFAOYSA-N |
| SMILES | C1COCCC1OCC2=CC=C(C=C2)C#CC3=C(C(=CC=C3)C(=O)O)C4=CC5=C(C=C4)C=CN5 |
Computed by PubChem (NCBI)