Products 193090-61-8
CAS 193090-61-8 appears in our catalog under these names: 4-Amino-2,3-dichlorobenzonitrile, 95%, 4–Amino–2，3–dichlorobenzonitrile, 4-Amino-2,3-dichlorobenzonitrile 95%, 4-Amino-2，3-dichlorobenzonitrile, 97%, 97%, 4-AMINO-2,3-DICHLOROBENZONITRILE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 25g.
4-amino-2,3-dichlorobenzonitrile (CAS 193090-61-8) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 4-amino-2,3-dichlorobenzonitrile. InChIKey: XDJNPFJHLFODNI-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 4-amino-2,3-dichlorobenzonitrile |
| InChIKey | XDJNPFJHLFODNI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)Cl)Cl)N |
Computed by PubChem (NCBI)