CAS 19314-92-2 is the registry number for 6,8-Dihydroxy-3-methylisochroman-1-one. Offered by: TRC. Available pack sizes: 100mg.
6,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one (CAS 19314-92-2) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 6,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one. InChIKey: DHLPMLVSBRRUGA-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 6,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one |
| InChIKey | DHLPMLVSBRRUGA-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C(=CC(=C2)O)O)C(=O)O1 |
Computed by PubChem (NCBI)