CAS 19317-11-4 appears in our catalog under these names: Farnesal (Mixture of Isomers, Technical Grade), FARNESAL, MIXTURE OF ISOMERS TECHNICAL, Farnesal, ≥85%, ≥85%, Farnesal (mixture of isomers), 96%. Offered by: TRC, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 100mg, 10mg, 50mg, 1ML, 1g, 5g, 25g, 10g.
3,7,11-trimethyldodeca-2,6,10-trienal (CAS 19317-11-4) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: 3,7,11-trimethyldodeca-2,6,10-trienal. InChIKey: YHRUHBBTQZKMEX-UHFFFAOYSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | 3,7,11-trimethyldodeca-2,6,10-trienal |
| InChIKey | YHRUHBBTQZKMEX-UHFFFAOYSA-N |
| SMILES | CC(=CCCC(=CCCC(=CC=O)C)C)C |
Computed by PubChem (NCBI)