Products 1931895-14-5
CAS 1931895-14-5 is the registry number for N3-1,4-trans-CHC-OH. Offered by: Iris Biotech, Biosynth, MedChemExpress. Available pack sizes: 1g, 5g, 25g, 100mg, 500mg, 2,5g, 250mg, Get quote.
4-azidocyclohexane-1-carboxylic acid (CAS 1931895-14-5) is a chemical compound with the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. IUPAC name: 4-azidocyclohexane-1-carboxylic acid. InChIKey: APIATWTVGOEUSS-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O2 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 4-azidocyclohexane-1-carboxylic acid |
| InChIKey | APIATWTVGOEUSS-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)
Synonyms:
(1s,4s)-4-azidocyclohexane-1-carboxylic acid, N3-1,4-trans-CHC-OH, N3-1,4-cis-CHC-OH, trans-4-azidocyclohexanecarboxylic acid, (1r,4r)-4-azidocyclohexane-1-carboxylic acid, N3-1,4-TRANS-CHC-OH, trans, cis-4-azidocyclohexanecarboxylic acid, 4-azidocyclohexane-1-carboxylic acid, cis-4-Azidocyclohexane carboxylic acid, orb2663731