Products 1931952-50-9
CAS 1931952-50-9 is the registry number for (3R,5R)-5-(5-Methyl-1,3,4-oxadiazol-2-yl)pyrrolidin-3-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3R,5R)-5-(5-methyl-1,3,4-oxadiazol-2-yl)pyrrolidin-3-ol (CAS 1931952-50-9) is a chemical compound with the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. IUPAC name: (3R,5R)-5-(5-methyl-1,3,4-oxadiazol-2-yl)pyrrolidin-3-ol. InChIKey: ULQJTPGLKNZNIB-PHDIDXHHSA-N.
| Molecular formula | C7H11N3O2 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | (3R,5R)-5-(5-methyl-1,3,4-oxadiazol-2-yl)pyrrolidin-3-ol |
| InChIKey | ULQJTPGLKNZNIB-PHDIDXHHSA-N |
| SMILES | CC1=NN=C(O1)[C@H]2C[C@H](CN2)O |
Computed by PubChem (NCBI)