Products 1932092-98-2
CAS 1932092-98-2 is the registry number for potassium (2,2-difluoro-5-methoxycarbonyl-spiro[2.3]hexan-1-yl)-trifluoro-boranuide, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 3-[(1S)-1-amino-2-methoxy-2-oxoethyl]azetidine-1-carboxylate (CAS 1932092-98-2) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: tert-butyl 3-[(1S)-1-amino-2-methoxy-2-oxoethyl]azetidine-1-carboxylate. InChIKey: HGSNWIDVQSMJKV-QMMMGPOBSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | tert-butyl 3-[(1S)-1-amino-2-methoxy-2-oxoethyl]azetidine-1-carboxylate |
| InChIKey | HGSNWIDVQSMJKV-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)[C@@H](C(=O)OC)N |
Computed by PubChem (NCBI)