CAS 1932096-99-5 is the registry number for Cinacalcet Impurity 130. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(7,8-dihydronaphthalen-1-yl)ethanamine (CAS 1932096-99-5) is a chemical compound with the molecular formula C12H15N and a molecular weight of 173.25 g/mol. IUPAC name: (1S)-1-(7,8-dihydronaphthalen-1-yl)ethanamine. InChIKey: RNQURMSZVUIKPK-VIFPVBQESA-N.
| Molecular formula | C12H15N |
|---|---|
| Molecular weight | 173.25 g/mol |
| IUPAC name | (1S)-1-(7,8-dihydronaphthalen-1-yl)ethanamine |
| InChIKey | RNQURMSZVUIKPK-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC=CC2=C1CCC=C2)N |
Computed by PubChem (NCBI)