CAS 1932101-55-7 is the registry number for (1R,3R)-3-Amino-1-(trifluoromethyl)cyclohexanol, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
Cis-(1R,3R)-3-amino-1-(trifluoromethyl)cyclohexan-1-ol (CAS 1932101-55-7) is a chemical compound with the molecular formula C7H12F3NO and a molecular weight of 183.17 g/mol. IUPAC name: cis-(1R,3R)-3-amino-1-(trifluoromethyl)cyclohexan-1-ol. InChIKey: IJUVZQHBPFIBHU-PHDIDXHHSA-N.
| Molecular formula | C7H12F3NO |
|---|---|
| Molecular weight | 183.17 g/mol |
| IUPAC name | cis-(1R,3R)-3-amino-1-(trifluoromethyl)cyclohexan-1-ol |
| InChIKey | IJUVZQHBPFIBHU-PHDIDXHHSA-N |
| SMILES | C1C[C@H](C[C@](C1)(C(F)(F)F)O)N |
Computed by PubChem (NCBI)