Products 2664977-43-7
CAS 2664977-43-7 is the registry number for (1S,3S)-3-AMINO-1-(TRIFLUOROMETHYL)CYCLOHEXANOL, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Cis-(1S,3S)-3-amino-1-(trifluoromethyl)cyclohexan-1-ol (CAS 2664977-43-7) is a chemical compound with the molecular formula C7H12F3NO and a molecular weight of 183.17 g/mol. IUPAC name: cis-(1S,3S)-3-amino-1-(trifluoromethyl)cyclohexan-1-ol. InChIKey: IJUVZQHBPFIBHU-WDSKDSINSA-N.
| Molecular formula | C7H12F3NO |
|---|---|
| Molecular weight | 183.17 g/mol |
| IUPAC name | cis-(1S,3S)-3-amino-1-(trifluoromethyl)cyclohexan-1-ol |
| InChIKey | IJUVZQHBPFIBHU-WDSKDSINSA-N |
| SMILES | C1C[C@@H](C[C@@](C1)(C(F)(F)F)O)N |
Computed by PubChem (NCBI)