Products 1932132-06-3
CAS 1932132-06-3 is the registry number for (1S,2R,3S,4R)-3-(Methoxycarbonyl)bicyclo[2.2.1]heptane-2-carboxylic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1S,2R,3S,4R)-3-methoxycarbonylbicyclo[2.2.1]heptane-2-carboxylic acid (CAS 1932132-06-3) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: (1S,2R,3S,4R)-3-methoxycarbonylbicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: AIMKQBORRFFXGP-OSMVPFSASA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | (1S,2R,3S,4R)-3-methoxycarbonylbicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | AIMKQBORRFFXGP-OSMVPFSASA-N |
| SMILES | COC(=O)[C@H]1[C@@H]2CC[C@@H](C2)[C@H]1C(=O)O |
Computed by PubChem (NCBI)