Products 1932135-92-6
CAS 1932135-92-6 is the registry number for rac-(5R,6R)-5-Amino-6-(1-methyl-1H-imidazol-2-yl)piperidin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(5R,6R)-5-amino-6-(1-methylimidazol-2-yl)piperidin-2-one (CAS 1932135-92-6) is a chemical compound with the molecular formula C9H14N4O and a molecular weight of 194.23 g/mol. IUPAC name: (5R,6R)-5-amino-6-(1-methylimidazol-2-yl)piperidin-2-one. InChIKey: CEHGCOZLRVETJM-HTRCEHHLSA-N.
| Molecular formula | C9H14N4O |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | (5R,6R)-5-amino-6-(1-methylimidazol-2-yl)piperidin-2-one |
| InChIKey | CEHGCOZLRVETJM-HTRCEHHLSA-N |
| SMILES | CN1C=CN=C1[C@H]2[C@@H](CCC(=O)N2)N |
Computed by PubChem (NCBI)