CAS 1932152-59-4 is the registry number for benzyl N-[(3S,4S)-4-hydroxypyrrolidin-3-yl]carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Benzyl N-[(3S,4S)-4-hydroxypyrrolidin-3-yl]carbamate (CAS 1932152-59-4) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: benzyl N-[(3S,4S)-4-hydroxypyrrolidin-3-yl]carbamate. InChIKey: XFRZHUKQUUVRFG-QWRGUYRKSA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | benzyl N-[(3S,4S)-4-hydroxypyrrolidin-3-yl]carbamate |
| InChIKey | XFRZHUKQUUVRFG-QWRGUYRKSA-N |
| SMILES | C1[C@@H]([C@H](CN1)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)