Products 1932289-71-8
CAS 1932289-71-8 appears in our catalog under these names: tert-Butyl N-((3R)-1-amino-4-methylpentan-3-yl)carbamate, 95%, tert-Butyl N-((3R)-1-amino-4-methylpentan-3-yl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl N-[(3R)-1-amino-4-methylpentan-3-yl]carbamate (CAS 1932289-71-8) is a chemical compound with the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. IUPAC name: tert-butyl N-[(3R)-1-amino-4-methylpentan-3-yl]carbamate. InChIKey: TZVDFSBPCDPXQW-SECBINFHSA-N.
| Molecular formula | C11H24N2O2 |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | tert-butyl N-[(3R)-1-amino-4-methylpentan-3-yl]carbamate |
| InChIKey | TZVDFSBPCDPXQW-SECBINFHSA-N |
| SMILES | CC(C)[C@@H](CCN)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)