CAS 1932297-75-0 appears in our catalog under these names: (R)-3-Amino-1-(tert-butoxycarbonyl)pyrrolidine-3-carboxylic acid, 97%, 97%, (3R)-3-AMINO-1-(TERT-BUTOXYCARBONYL)PYRROLIDINE-3-CARBOXYLIC ACID, 97%, (R)-3-Amino-1-(tert-butoxycarbonyl)pyrrolidine-3-carboxylic acid 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
(3R)-3-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1932297-75-0) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: (3R)-3-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: RBVXSBGDNJDEIF-SNVBAGLBSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (3R)-3-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | RBVXSBGDNJDEIF-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@](C1)(C(=O)O)N |
Computed by PubChem (NCBI)