Products 1932338-50-5
CAS 1932338-50-5 is the registry number for tert-butyl (1S,4S,5R)-5-amino-2-azabicyclo[2.2.2]octane-2-carboxylate. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (1R,4R,5R)-5-amino-2-azabicyclo[2.2.2]octane-2-carboxylate (CAS 1932338-50-5) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl (1R,4R,5R)-5-amino-2-azabicyclo[2.2.2]octane-2-carboxylate. InChIKey: SIFPHPJZXMHDLP-OPRDCNLKSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl (1R,4R,5R)-5-amino-2-azabicyclo[2.2.2]octane-2-carboxylate |
| InChIKey | SIFPHPJZXMHDLP-OPRDCNLKSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC[C@@H]1C[C@H]2N |
Computed by PubChem (NCBI)