Products 1932538-55-0
CAS 1932538-55-0 is the registry number for (2R,3R)-3-amino-1-tert-butoxycarbonyl-pyrrolidine-2-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
(2R,3R)-3-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 1932538-55-0) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: (2R,3R)-3-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: XJLRVKYPDQPRIE-RNFRBKRXSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (2R,3R)-3-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | XJLRVKYPDQPRIE-RNFRBKRXSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H]1C(=O)O)N |
Computed by PubChem (NCBI)