CAS 1932546-67-2 appears in our catalog under these names: tert-Butyl (4aS,7aS)-hexahydropyrrolo[3,4-b][1,4]oxazine-6(2H)-carboxylate 95%, TERT-BUTYL (4AS,7AS)-OCTAHYDROPYRROLO[3,4-B]MORPHOLINE-6-CARBOXYLATE, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Tert-butyl (4aS,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxylate (CAS 1932546-67-2) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl (4aS,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxylate. InChIKey: AUXXIKSVHUSTOA-IUCAKERBSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl (4aS,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxylate |
| InChIKey | AUXXIKSVHUSTOA-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2[C@H](C1)OCCN2 |
Computed by PubChem (NCBI)