CAS 1932565-83-7 is the registry number for tert-Butyl ((3R,5S)-5-(hydroxymethyl)-2-oxopyrrolidin-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(3R,5S)-5-(hydroxymethyl)-2-oxopyrrolidin-3-yl]carbamate (CAS 1932565-83-7) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: tert-butyl N-[(3R,5S)-5-(hydroxymethyl)-2-oxopyrrolidin-3-yl]carbamate. InChIKey: XYBDBDPPAQAHNV-NKWVEPMBSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | tert-butyl N-[(3R,5S)-5-(hydroxymethyl)-2-oxopyrrolidin-3-yl]carbamate |
| InChIKey | XYBDBDPPAQAHNV-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](NC1=O)CO |
Computed by PubChem (NCBI)